C18H30O4 — CID 129102751
10-prop-2-enoyloxydecyl 2-methylidenebutanoate (PubChem CID 129102751) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 10-prop-2-enoyloxydecyl 2-methylidenebutanoate.
| Compound Name | 10-prop-2-enoyloxydecyl 2-methylidenebutanoate |
|---|---|
| PubChem CID | 129102751 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 10-prop-2-enoyloxydecyl 2-methylidenebutanoate |
| SMILES | C=CC(=O)OCCCCCCCCCCOC(=O)C(=C)CC |
| InChI | InChI=1S/C18H30O4/c1-4-16(3)18(20)22-15-13-11-9-7-6-8-10-12-14-21-17(19)5-2/h5H,2-4,6-15H2,1H3 |
| InChIKey | JBCBAMLRHVPNGY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|