About 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate
3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate (PubChem CID 162118365) has the molecular formula C18H24O8
and a molecular weight of 368.38 g/mol. Its IUPAC name is 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate |
| PubChem CID | 162118365 |
| Molecular Formula | C18H24O8 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC(C)OC(=O)C=C.C=CC(=O)OCCOC(=O)C=C |
| InChI | InChI=1S/C10H14O4.C8H10O4/c1-4-9(11)13-7-6-8(3)14-10(12)5-2;1-3-7(9)11-5-6-12-8(10)4-2/h4-5,8H,1-2,6-7H2,3H3;3-4H,1-2,5-6H2 |
| InChIKey | ZHBOZEGVXPLNNM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate?
The IUPAC name of 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate (CID 162118365) is 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate.
What is the SMILES notation for 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate?
The canonical SMILES for 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate is C=CC(=O)OCCC(C)OC(=O)C=C.C=CC(=O)OCCOC(=O)C=C.
What is the InChIKey of 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate?
The InChIKey is ZHBOZEGVXPLNNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4.C8H10O4/c1-4-9(11)13-7-6-8(3)14-10(12)5-2;1-3-7(9)11-5-6-12-8(10)4-2/h4-5,8H,1-2,6-7H2,3H3;3-4H,1-2,5-6H2.
What are the key properties of 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate?
3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate has a molecular weight of 368.38 g/mol, XLogP of 1.67, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-enoyloxybutyl prop-2-enoate;2-prop-2-enoyloxyethyl prop-2-enoate is sourced from PubChem (CID 162118365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).