C7H13O5PS — CID 174977844
4-dihydroxyphosphinothioyloxybutan-2-yl prop-2-enoate (PubChem CID 174977844) has the molecular formula C7H13O5PS and a molecular weight of 240.22 g/mol. Its IUPAC name is 4-dihydroxyphosphinothioyloxybutan-2-yl prop-2-enoate.
| Compound Name | 4-dihydroxyphosphinothioyloxybutan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 174977844 |
| Molecular Formula | C7H13O5PS |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 4-dihydroxyphosphinothioyloxybutan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCOP(O)(O)=S |
| InChI | InChI=1S/C7H13O5PS/c1-3-7(8)12-6(2)4-5-11-13(9,10)14/h3,6H,1,4-5H2,2H3,(H2,9,10,14) |
| InChIKey | QUCSEKITJPDGEC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|