C21H30O8 — CID 162239045
3-prop-2-enoyloxybutyl prop-2-enoate;5-prop-2-enoyloxypentyl prop-2-enoate (PubChem CID 162239045) has the molecular formula C21H30O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is 3-prop-2-enoyloxybutyl prop-2-enoate;5-prop-2-enoyloxypentyl prop-2-enoate.
| Compound Name | 3-prop-2-enoyloxybutyl prop-2-enoate;5-prop-2-enoyloxypentyl prop-2-enoate |
|---|---|
| PubChem CID | 162239045 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | 3-prop-2-enoyloxybutyl prop-2-enoate;5-prop-2-enoyloxypentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC(C)OC(=O)C=C.C=CC(=O)OCCCCCOC(=O)C=C |
| InChI | InChI=1S/C11H16O4.C10H14O4/c1-3-10(12)14-8-6-5-7-9-15-11(13)4-2;1-4-9(11)13-7-6-8(3)14-10(12)5-2/h3-4H,1-2,5-9H2;4-5,8H,1-2,6-7H2,3H3 |
| InChIKey | ZWLLPRUGNLMFNO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|