C8H13BrO3 — CID 57007921
2-(2-bromopropoxy)ethyl prop-2-enoate (PubChem CID 57007921) has the molecular formula C8H13BrO3 and a molecular weight of 237.09 g/mol. Its IUPAC name is 2-(2-bromopropoxy)ethyl prop-2-enoate.
| Compound Name | 2-(2-bromopropoxy)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 57007921 |
| Molecular Formula | C8H13BrO3 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 2-(2-bromopropoxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCC(C)Br |
| InChI | InChI=1S/C8H13BrO3/c1-3-8(10)12-5-4-11-6-7(2)9/h3,7H,1,4-6H2,2H3 |
| InChIKey | KQDLSBOVYWEJLT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|