C15H26O6 — CID 88684060
2-butoxyethyl prop-2-enoate;2-hydroxypropyl prop-2-enoate (PubChem CID 88684060) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-butoxyethyl prop-2-enoate;2-hydroxypropyl prop-2-enoate.
| Compound Name | 2-butoxyethyl prop-2-enoate;2-hydroxypropyl prop-2-enoate |
|---|---|
| PubChem CID | 88684060 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-butoxyethyl prop-2-enoate;2-hydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)O.C=CC(=O)OCCOCCCC |
| InChI | InChI=1S/C9H16O3.C6H10O3/c1-3-5-6-11-7-8-12-9(10)4-2;1-3-6(8)9-4-5(2)7/h4H,2-3,5-8H2,1H3;3,5,7H,1,4H2,2H3 |
| InChIKey | SHDFVOMVLNVAAV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|