C19H32O6 — CID 118062251
bis(prop-1-ene);2-[2-(2-prop-2-enoyloxyethoxy)propoxy]ethyl prop-2-enoate (PubChem CID 118062251) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is bis(prop-1-ene);2-[2-(2-prop-2-enoyloxyethoxy)propoxy]ethyl prop-2-enoate.
| Compound Name | bis(prop-1-ene);2-[2-(2-prop-2-enoyloxyethoxy)propoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 118062251 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | bis(prop-1-ene);2-[2-(2-prop-2-enoyloxyethoxy)propoxy]ethyl prop-2-enoate |
| SMILES | C=CC.C=CC.C=CC(=O)OCCOCC(C)OCCOC(=O)C=C |
| InChI | InChI=1S/C13H20O6.2C3H6/c1-4-12(14)18-7-6-16-10-11(3)17-8-9-19-13(15)5-2;2*1-3-2/h4-5,11H,1-2,6-10H2,3H3;2*3H,1H2,2H3 |
| InChIKey | CFYMTNURYXLXHN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|