About 2-acetyloxyethyl acetate;buta-1,3-diene
2-acetyloxyethyl acetate;buta-1,3-diene (PubChem CID 87510767) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-acetyloxyethyl acetate;buta-1,3-diene.
Molecular Properties
| Compound Name | 2-acetyloxyethyl acetate;buta-1,3-diene |
| PubChem CID | 87510767 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-acetyloxyethyl acetate;buta-1,3-diene |
| SMILES | C=CC=C.CC(=O)OCCOC(C)=O |
| InChI | InChI=1S/C6H10O4.C4H6/c1-5(7)9-3-4-10-6(2)8;1-3-4-2/h3-4H2,1-2H3;3-4H,1-2H2 |
| InChIKey | AFFLFOWUJZWLSW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethyl acetate;buta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethyl acetate;buta-1,3-diene?
The IUPAC name of 2-acetyloxyethyl acetate;buta-1,3-diene (CID 87510767) is 2-acetyloxyethyl acetate;buta-1,3-diene.
What is the SMILES notation for 2-acetyloxyethyl acetate;buta-1,3-diene?
The canonical SMILES for 2-acetyloxyethyl acetate;buta-1,3-diene is C=CC=C.CC(=O)OCCOC(C)=O.
What is the InChIKey of 2-acetyloxyethyl acetate;buta-1,3-diene?
The InChIKey is AFFLFOWUJZWLSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.C4H6/c1-5(7)9-3-4-10-6(2)8;1-3-4-2/h3-4H2,1-2H3;3-4H,1-2H2.
What are the key properties of 2-acetyloxyethyl acetate;buta-1,3-diene?
2-acetyloxyethyl acetate;buta-1,3-diene has a molecular weight of 200.23 g/mol, XLogP of 1.47, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethyl acetate;buta-1,3-diene is sourced from PubChem (CID 87510767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).