About bis(2-acetyloxyethyl acetate);amino acetate
bis(2-acetyloxyethyl acetate);amino acetate (PubChem CID 87902922) has the molecular formula C14H25NO10
and a molecular weight of 367.35 g/mol. Its IUPAC name is bis(2-acetyloxyethyl acetate);amino acetate.
Molecular Properties
| Compound Name | bis(2-acetyloxyethyl acetate);amino acetate |
| PubChem CID | 87902922 |
| Molecular Formula | C14H25NO10 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | bis(2-acetyloxyethyl acetate);amino acetate |
| SMILES | CC(=O)OCCOC(C)=O.CC(=O)OCCOC(C)=O.CC(=O)ON |
| InChI | InChI=1S/2C6H10O4.C2H5NO2/c2*1-5(7)9-3-4-10-6(2)8;1-2(4)5-3/h2*3-4H2,1-2H3;3H2,1H3 |
| InChIKey | YOSDRYRGAZJWCF-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 157.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-acetyloxyethyl acetate);amino acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-acetyloxyethyl acetate);amino acetate?
The IUPAC name of bis(2-acetyloxyethyl acetate);amino acetate (CID 87902922) is bis(2-acetyloxyethyl acetate);amino acetate.
What is the SMILES notation for bis(2-acetyloxyethyl acetate);amino acetate?
The canonical SMILES for bis(2-acetyloxyethyl acetate);amino acetate is CC(=O)OCCOC(C)=O.CC(=O)OCCOC(C)=O.CC(=O)ON.
What is the InChIKey of bis(2-acetyloxyethyl acetate);amino acetate?
The InChIKey is YOSDRYRGAZJWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H10O4.C2H5NO2/c2*1-5(7)9-3-4-10-6(2)8;1-2(4)5-3/h2*3-4H2,1-2H3;3H2,1H3.
What are the key properties of bis(2-acetyloxyethyl acetate);amino acetate?
bis(2-acetyloxyethyl acetate);amino acetate has a molecular weight of 367.35 g/mol, XLogP of -0.35, 6 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-acetyloxyethyl acetate);amino acetate is sourced from PubChem (CID 87902922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).