About 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate
2-hydroxyethyl 3-oxobutanoate;prop-2-enoate (PubChem CID 20976000) has the molecular formula C9H13O6-
and a molecular weight of 217.20 g/mol. Its IUPAC name is 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate |
| PubChem CID | 20976000 |
| Molecular Formula | C9H13O6- |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate |
| SMILES | C=CC(=O)[O-].CC(=O)CC(=O)OCCO |
| InChI | InChI=1S/C6H10O4.C3H4O2/c1-5(8)4-6(9)10-3-2-7;1-2-3(4)5/h7H,2-4H2,1H3;2H,1H2,(H,4,5)/p-1 |
| InChIKey | VQVANEKSBWTIKQ-UHFFFAOYSA-M |
| XLogP | -1.58 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate?
The IUPAC name of 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate (CID 20976000) is 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate.
What is the SMILES notation for 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate?
The canonical SMILES for 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate is C=CC(=O)[O-].CC(=O)CC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate?
The InChIKey is VQVANEKSBWTIKQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O4.C3H4O2/c1-5(8)4-6(9)10-3-2-7;1-2-3(4)5/h7H,2-4H2,1H3;2H,1H2,(H,4,5)/p-1.
What are the key properties of 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate?
2-hydroxyethyl 3-oxobutanoate;prop-2-enoate has a molecular weight of 217.20 g/mol, XLogP of -1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 3-oxobutanoate;prop-2-enoate is sourced from PubChem (CID 20976000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).