About 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene)
2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) (PubChem CID 173070225) has the molecular formula C23H44O3
and a molecular weight of 368.60 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene).
Molecular Properties
| Compound Name | 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) |
| PubChem CID | 173070225 |
| Molecular Formula | C23H44O3 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 368.33 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) |
| SMILES | C=CC.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC(=O)OCCO |
| InChI | InChI=1S/C5H8O3.6C3H6/c1-2-5(7)8-4-3-6;6*1-3-2/h2,6H,1,3-4H2;6*3H,1H2,2H3 |
| InChIKey | OGIDVGGPKJPUCF-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene)?
The IUPAC name of 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) (CID 173070225) is 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene).
What is the SMILES notation for 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene)?
The canonical SMILES for 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) is C=CC.C=CC.C=CC.C=CC.C=CC.C=CC.C=CC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene)?
The InChIKey is OGIDVGGPKJPUCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.6C3H6/c1-2-5(7)8-4-3-6;6*1-3-2/h2,6H,1,3-4H2;6*3H,1H2,2H3.
What are the key properties of 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene)?
2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) has a molecular weight of 368.60 g/mol, XLogP of 6.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl prop-2-enoate;hexakis(prop-1-ene) is sourced from PubChem (CID 173070225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).