About 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate
2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate (PubChem CID 173020025) has the molecular formula C11H16O6
and a molecular weight of 244.24 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate |
| PubChem CID | 173020025 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate |
| SMILES | C=CC(=O)OCC=CO.C=CC(=O)OCCO |
| InChI | InChI=1S/C6H8O3.C5H8O3/c1-2-6(8)9-5-3-4-7;1-2-5(7)8-4-3-6/h2-4,7H,1,5H2;2,6H,1,3-4H2 |
| InChIKey | KHJUZFOOVVGCIF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate?
The IUPAC name of 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate (CID 173020025) is 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate.
What is the SMILES notation for 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate?
The canonical SMILES for 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate is C=CC(=O)OCC=CO.C=CC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate?
The InChIKey is KHJUZFOOVVGCIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.C5H8O3/c1-2-6(8)9-5-3-4-7;1-2-5(7)8-4-3-6/h2-4,7H,1,5H2;2,6H,1,3-4H2.
What are the key properties of 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate?
2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate has a molecular weight of 244.24 g/mol, XLogP of 0.50, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl prop-2-enoate;3-hydroxyprop-2-enyl prop-2-enoate is sourced from PubChem (CID 173020025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).