About 3-hydroxyprop-2-enyl prop-2-enoate;methane
3-hydroxyprop-2-enyl prop-2-enoate;methane (PubChem CID 173438743) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 3-hydroxyprop-2-enyl prop-2-enoate;methane.
Molecular Properties
| Compound Name | 3-hydroxyprop-2-enyl prop-2-enoate;methane |
| PubChem CID | 173438743 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 3-hydroxyprop-2-enyl prop-2-enoate;methane |
| SMILES | C.C=CC(=O)OCC=CO |
| InChI | InChI=1S/C6H8O3.CH4/c1-2-6(8)9-5-3-4-7;/h2-4,7H,1,5H2;1H4 |
| InChIKey | PLXBUFYWKFTAIX-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyprop-2-enyl prop-2-enoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyprop-2-enyl prop-2-enoate;methane?
The IUPAC name of 3-hydroxyprop-2-enyl prop-2-enoate;methane (CID 173438743) is 3-hydroxyprop-2-enyl prop-2-enoate;methane.
What is the SMILES notation for 3-hydroxyprop-2-enyl prop-2-enoate;methane?
The canonical SMILES for 3-hydroxyprop-2-enyl prop-2-enoate;methane is C.C=CC(=O)OCC=CO.
What is the InChIKey of 3-hydroxyprop-2-enyl prop-2-enoate;methane?
The InChIKey is PLXBUFYWKFTAIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3.CH4/c1-2-6(8)9-5-3-4-7;/h2-4,7H,1,5H2;1H4.
What are the key properties of 3-hydroxyprop-2-enyl prop-2-enoate;methane?
3-hydroxyprop-2-enyl prop-2-enoate;methane has a molecular weight of 144.17 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyprop-2-enyl prop-2-enoate;methane is sourced from PubChem (CID 173438743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).