C9H7F7O2 — CID 76599744
[4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enyl] prop-2-enoate (PubChem CID 76599744) has the molecular formula C9H7F7O2 and a molecular weight of 280.14 g/mol. Its IUPAC name is [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enyl] prop-2-enoate.
| Compound Name | [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 76599744 |
| Molecular Formula | C9H7F7O2 |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | [4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC=CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H7F7O2/c1-2-6(17)18-5-3-4-7(10,8(11,12)13)9(14,15)16/h2-4H,1,5H2 |
| InChIKey | OMRLKIPNKOKRKQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|