C11H10F8O4 — CID 134264826
2,2,3,3,3-pentafluoropropyl prop-2-enoate;2,2,2-trifluoroethyl prop-2-enoate (PubChem CID 134264826) has the molecular formula C11H10F8O4 and a molecular weight of 358.18 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoropropyl prop-2-enoate;2,2,2-trifluoroethyl prop-2-enoate.
| Compound Name | 2,2,3,3,3-pentafluoropropyl prop-2-enoate;2,2,2-trifluoroethyl prop-2-enoate |
|---|---|
| PubChem CID | 134264826 |
| Molecular Formula | C11H10F8O4 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoropropyl prop-2-enoate;2,2,2-trifluoroethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)F.C=CC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C6H5F5O2.C5H5F3O2/c1-2-4(12)13-3-5(7,8)6(9,10)11;1-2-4(9)10-3-5(6,7)8/h2H,1,3H2;2H,1,3H2 |
| InChIKey | NNWRIWIYLGZWQL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|