C7H6F6O3 — CID 89110731
[3-(difluoromethoxy)-2,2,3,3-tetrafluoropropyl] prop-2-enoate (PubChem CID 89110731) has the molecular formula C7H6F6O3 and a molecular weight of 252.11 g/mol. Its IUPAC name is [3-(difluoromethoxy)-2,2,3,3-tetrafluoropropyl] prop-2-enoate.
| Compound Name | [3-(difluoromethoxy)-2,2,3,3-tetrafluoropropyl] prop-2-enoate |
|---|---|
| PubChem CID | 89110731 |
| Molecular Formula | C7H6F6O3 |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | [3-(difluoromethoxy)-2,2,3,3-tetrafluoropropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)OC(F)F |
| InChI | InChI=1S/C7H6F6O3/c1-2-4(14)15-3-6(10,11)7(12,13)16-5(8)9/h2,5H,1,3H2 |
| InChIKey | SEFQXQJEFNGUDF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|