C13H10F10O7 — CID 87065443
[2-[2-[(1,1-difluoro-2-prop-2-enoyloxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] prop-2-enoate (PubChem CID 87065443) has the molecular formula C13H10F10O7 and a molecular weight of 468.20 g/mol. Its IUPAC name is [2-[2-[(1,1-difluoro-2-prop-2-enoyloxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] prop-2-enoate.
| Compound Name | [2-[2-[(1,1-difluoro-2-prop-2-enoyloxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] prop-2-enoate |
|---|---|
| PubChem CID | 87065443 |
| Molecular Formula | C13H10F10O7 |
| Molecular Weight | 468.20 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | [2-[2-[(1,1-difluoro-2-prop-2-enoyloxyethoxy)-difluoromethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)OC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)COC(=O)C=C |
| InChI | InChI=1S/C13H10F10O7/c1-3-7(24)26-5-9(14,15)28-11(18,19)12(20,21)30-13(22,23)29-10(16,17)6-27-8(25)4-2/h3-4H,1-2,5-6H2 |
| InChIKey | WHGKRECGQHYUHL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.20 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|