C11H5F15O3 — CID 140957950
[2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)ethyl] prop-2-enoate (PubChem CID 140957950) has the molecular formula C11H5F15O3 and a molecular weight of 470.13 g/mol. Its IUPAC name is [2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)ethyl] prop-2-enoate.
| Compound Name | [2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 140957950 |
| Molecular Formula | C11H5F15O3 |
| Molecular Weight | 470.13 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | [2,2-difluoro-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F15O3/c1-2-4(27)28-3-5(12,13)29-11(25,26)9(20,21)7(16,17)6(14,15)8(18,19)10(22,23)24/h2H,1,3H2 |
| InChIKey | QPWVHDLAXJXPEC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.13 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|