C7H9F3O3 — CID 58173753
(3,3,3-trifluoro-2-hydroxy-2-methylpropyl) prop-2-enoate (PubChem CID 58173753) has the molecular formula C7H9F3O3 and a molecular weight of 198.14 g/mol. Its IUPAC name is (3,3,3-trifluoro-2-hydroxy-2-methylpropyl) prop-2-enoate.
| Compound Name | (3,3,3-trifluoro-2-hydroxy-2-methylpropyl) prop-2-enoate |
|---|---|
| PubChem CID | 58173753 |
| Molecular Formula | C7H9F3O3 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (3,3,3-trifluoro-2-hydroxy-2-methylpropyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C7H9F3O3/c1-3-5(11)13-4-6(2,12)7(8,9)10/h3,12H,1,4H2,2H3 |
| InChIKey | JTTZPMXJFGDHBD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|