C19H26F4O6 — CID 54085907
(2,2-dimethyl-3-prop-2-enoyloxypropyl) prop-2-enoate;2-methylprop-2-enyl prop-2-enoate;tetrafluoromethane (PubChem CID 54085907) has the molecular formula C19H26F4O6 and a molecular weight of 426.40 g/mol. Its IUPAC name is (2,2-dimethyl-3-prop-2-enoyloxypropyl) prop-2-enoate;2-methylprop-2-enyl prop-2-enoate;tetrafluoromethane.
| Compound Name | (2,2-dimethyl-3-prop-2-enoyloxypropyl) prop-2-enoate;2-methylprop-2-enyl prop-2-enoate;tetrafluoromethane |
|---|---|
| PubChem CID | 54085907 |
| Molecular Formula | C19H26F4O6 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (2,2-dimethyl-3-prop-2-enoyloxypropyl) prop-2-enoate;2-methylprop-2-enyl prop-2-enoate;tetrafluoromethane |
| SMILES | C=CC(=O)OCC(=C)C.C=CC(=O)OCC(C)(C)COC(=O)C=C.FC(F)(F)F |
| InChI | InChI=1S/C11H16O4.C7H10O2.CF4/c1-5-9(12)14-7-11(3,4)8-15-10(13)6-2;1-4-7(8)9-5-6(2)3;2-1(3,4)5/h5-6H,1-2,7-8H2,3-4H3;4H,1-2,5H2,3H3; |
| InChIKey | MQLCEOLWBVDGCO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|