C32H30F12O12 — CID 118919135
[3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-prop-2-enoyloxy-2,2,9,9-tetrakis(prop-2-enoyloxymethyl)decyl] prop-2-enoate (PubChem CID 118919135) has the molecular formula C32H30F12O12 and a molecular weight of 834.56 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-prop-2-enoyloxy-2,2,9,9-tetrakis(prop-2-enoyloxymethyl)decyl] prop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-prop-2-enoyloxy-2,2,9,9-tetrakis(prop-2-enoyloxymethyl)decyl] prop-2-enoate |
|---|---|
| PubChem CID | 118919135 |
| Molecular Formula | C32H30F12O12 |
| Molecular Weight | 834.56 g/mol |
| Exact Mass | 834.15 |
| IUPAC Name | [3,3,4,4,5,5,6,6,7,7,8,8-dodecafluoro-10-prop-2-enoyloxy-2,2,9,9-tetrakis(prop-2-enoyloxymethyl)decyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)(COC(=O)C=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C32H30F12O12/c1-7-19(45)51-13-25(14-52-20(46)8-2,15-53-21(47)9-3)27(33,34)29(37,38)31(41,42)32(43,44)30(39,40)28(35,36)26(16-54-22(48)10-4,17-55-23(49)11-5)18-56-24(50)12-6/h7-12H,1-6,13-18H2 |
| InChIKey | WRGJOPBZASBUIW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|