C7H5F7O3 — CID 58030590
(2,2,3,3,4,4-hexafluoro-4-fluorooxybutyl) prop-2-enoate (PubChem CID 58030590) has the molecular formula C7H5F7O3 and a molecular weight of 270.10 g/mol. Its IUPAC name is (2,2,3,3,4,4-hexafluoro-4-fluorooxybutyl) prop-2-enoate.
| Compound Name | (2,2,3,3,4,4-hexafluoro-4-fluorooxybutyl) prop-2-enoate |
|---|---|
| PubChem CID | 58030590 |
| Molecular Formula | C7H5F7O3 |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | (2,2,3,3,4,4-hexafluoro-4-fluorooxybutyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)OF |
| InChI | InChI=1S/C7H5F7O3/c1-2-4(15)16-3-5(8,9)6(10,11)7(12,13)17-14/h2H,1,3H2 |
| InChIKey | WIKUISOPFYVYOA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|