C21H19F13O9 — CID 58122137
[2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis(1,1,2,2-tetrafluoro-3-prop-2-enoyloxypropoxy)propoxy]propyl] prop-2-enoate (PubChem CID 58122137) has the molecular formula C21H19F13O9 and a molecular weight of 662.35 g/mol. Its IUPAC name is [2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis(1,1,2,2-tetrafluoro-3-prop-2-enoyloxypropoxy)propoxy]propyl] prop-2-enoate.
| Compound Name | [2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis(1,1,2,2-tetrafluoro-3-prop-2-enoyloxypropoxy)propoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 58122137 |
| Molecular Formula | C21H19F13O9 |
| Molecular Weight | 662.35 g/mol |
| Exact Mass | 662.08 |
| IUPAC Name | [2,2,3,3-tetrafluoro-3-[2-fluoro-2,3-bis(1,1,2,2-tetrafluoro-3-prop-2-enoyloxypropoxy)propoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)OCC(F)(COC(F)(F)C(F)(F)COC(=O)C=C)OC(F)(F)C(F)(F)COC(=O)C=C |
| InChI | InChI=1S/C21H19F13O9/c1-4-12(35)38-9-16(23,24)19(29,30)41-7-15(22,43-21(33,34)18(27,28)11-40-14(37)6-3)8-42-20(31,32)17(25,26)10-39-13(36)5-2/h4-6H,1-3,7-11H2 |
| InChIKey | YSSGVFZDXRXRSS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|