C7H5F7O3 — CID 19824845
[1,1,2,2-tetrafluoro-3-(trifluoromethoxy)propyl] prop-2-enoate (PubChem CID 19824845) has the molecular formula C7H5F7O3 and a molecular weight of 270.10 g/mol. Its IUPAC name is [1,1,2,2-tetrafluoro-3-(trifluoromethoxy)propyl] prop-2-enoate.
| Compound Name | [1,1,2,2-tetrafluoro-3-(trifluoromethoxy)propyl] prop-2-enoate |
|---|---|
| PubChem CID | 19824845 |
| Molecular Formula | C7H5F7O3 |
| Molecular Weight | 270.10 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | [1,1,2,2-tetrafluoro-3-(trifluoromethoxy)propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)COC(F)(F)F |
| InChI | InChI=1S/C7H5F7O3/c1-2-4(15)17-6(10,11)5(8,9)3-16-7(12,13)14/h2H,1,3H2 |
| InChIKey | GRRXMQMCCQAVEI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.10 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|