C10H8F8O4 — CID 123690892
1,1,3,3,3-pentafluoropropyl prop-2-enoate;trifluoromethyl prop-2-enoate (PubChem CID 123690892) has the molecular formula C10H8F8O4 and a molecular weight of 344.15 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoropropyl prop-2-enoate;trifluoromethyl prop-2-enoate.
| Compound Name | 1,1,3,3,3-pentafluoropropyl prop-2-enoate;trifluoromethyl prop-2-enoate |
|---|---|
| PubChem CID | 123690892 |
| Molecular Formula | C10H8F8O4 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 1,1,3,3,3-pentafluoropropyl prop-2-enoate;trifluoromethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)CC(F)(F)F.C=CC(=O)OC(F)(F)F |
| InChI | InChI=1S/C6H5F5O2.C4H3F3O2/c1-2-4(12)13-6(10,11)3-5(7,8)9;1-2-3(8)9-4(5,6)7/h2H,1,3H2;2H,1H2 |
| InChIKey | JMQBICJZZFHDDN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|