C13H8F16O2 — CID 139715016
1,1,2,2,3,3,4,4,5,5,6,6,7,10,10,10-hexadecafluorodecyl prop-2-enoate (PubChem CID 139715016) has the molecular formula C13H8F16O2 and a molecular weight of 500.17 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,10,10,10-hexadecafluorodecyl prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,10,10,10-hexadecafluorodecyl prop-2-enoate |
|---|---|
| PubChem CID | 139715016 |
| Molecular Formula | C13H8F16O2 |
| Molecular Weight | 500.17 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,10,10,10-hexadecafluorodecyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCC(F)(F)F |
| InChI | InChI=1S/C13H8F16O2/c1-2-6(30)31-13(28,29)12(26,27)11(24,25)10(22,23)9(20,21)8(18,19)5(14)3-4-7(15,16)17/h2,5H,1,3-4H2 |
| InChIKey | NNAZOSGQYPWATG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.17 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|