C15H7F21O2 — CID 87290750
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-henicosafluorododecyl prop-2-enoate (PubChem CID 87290750) has the molecular formula C15H7F21O2 and a molecular weight of 618.18 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-henicosafluorododecyl prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-henicosafluorododecyl prop-2-enoate |
|---|---|
| PubChem CID | 87290750 |
| Molecular Formula | C15H7F21O2 |
| Molecular Weight | 618.18 g/mol |
| Exact Mass | 618.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-henicosafluorododecyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)F |
| InChI | InChI=1S/C15H7F21O2/c1-3-5(37)38-15(35,36)14(33,34)13(31,32)12(29,30)11(27,28)10(25,26)9(23,24)8(21,22)7(19,20)6(17,18)4(2)16/h3-4H,1H2,2H3 |
| InChIKey | GLRWDOZRWOFRKC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.18 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|