C18H15F17O5 — CID 162207507
1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl prop-2-enoate;2-hydroxyethyl prop-2-enoate (PubChem CID 162207507) has the molecular formula C18H15F17O5 and a molecular weight of 634.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl prop-2-enoate;2-hydroxyethyl prop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl prop-2-enoate;2-hydroxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 162207507 |
| Molecular Formula | C18H15F17O5 |
| Molecular Weight | 634.28 g/mol |
| Exact Mass | 634.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl prop-2-enoate;2-hydroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F.C=CC(=O)OCCO |
| InChI | InChI=1S/C13H7F17O2.C5H8O3/c1-2-5(31)32-13(29,30)12(27,28)11(25,26)10(23,24)9(21,22)8(19,20)6(14,15)3-4-7(16,17)18;1-2-5(7)8-4-3-6/h2H,1,3-4H2;2,6H,1,3-4H2 |
| InChIKey | ZSJYSSPNWRGQMQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.28 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|