C10H7F13O2 — CID 89413806
1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl acetate (PubChem CID 89413806) has the molecular formula C10H7F13O2 and a molecular weight of 406.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl acetate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl acetate |
|---|---|
| PubChem CID | 89413806 |
| Molecular Formula | C10H7F13O2 |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl acetate |
| SMILES | CC(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C10H7F13O2/c1-4(24)25-10(22,23)9(20,21)8(18,19)7(16,17)5(11,12)2-3-6(13,14)15/h2-3H2,1H3 |
| InChIKey | IEMXSHKHJLPZSM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|