C8H7F13OSi — CID 174993252
1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctoxysilane (PubChem CID 174993252) has the molecular formula C8H7F13OSi and a molecular weight of 394.20 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctoxysilane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctoxysilane |
|---|---|
| PubChem CID | 174993252 |
| Molecular Formula | C8H7F13OSi |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctoxysilane |
| SMILES | FC(F)(F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)O[SiH3] |
| InChI | InChI=1S/C8H7F13OSi/c9-3(10,1-2-4(11,12)13)5(14,15)6(16,17)7(18,19)8(20,21)22-23/h1-2H2,23H3 |
| InChIKey | LNELGSJCQTVACA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|