C16H19F17O2Si — CID 87247873
diethoxy-ethyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl)silane (PubChem CID 87247873) has the molecular formula C16H19F17O2Si and a molecular weight of 594.38 g/mol. Its IUPAC name is diethoxy-ethyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl)silane.
| Compound Name | diethoxy-ethyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl)silane |
|---|---|
| PubChem CID | 87247873 |
| Molecular Formula | C16H19F17O2Si |
| Molecular Weight | 594.38 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | diethoxy-ethyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,10,10,10-heptadecafluorodecyl)silane |
| SMILES | CCO[Si](CC)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C16H19F17O2Si/c1-4-34-36(6-3,35-5-2)16(32,33)15(30,31)14(28,29)13(26,27)12(24,25)11(22,23)9(17,18)7-8-10(19,20)21/h4-8H2,1-3H3 |
| InChIKey | GFKFKOYXHOBDMY-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.38 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|