C14H17F15O3Si — CID 175108663
triethoxy(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)silane (PubChem CID 175108663) has the molecular formula C14H17F15O3Si and a molecular weight of 546.34 g/mol. Its IUPAC name is triethoxy(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)silane.
| Compound Name | triethoxy(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)silane |
|---|---|
| PubChem CID | 175108663 |
| Molecular Formula | C14H17F15O3Si |
| Molecular Weight | 546.34 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | triethoxy(1,1,2,2,3,3,4,4,5,5,6,6,8,8,8-pentadecafluorooctyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C14H17F15O3Si/c1-4-30-33(31-5-2,32-6-3)14(28,29)13(26,27)12(24,25)11(22,23)10(20,21)8(15,16)7-9(17,18)19/h4-7H2,1-3H3 |
| InChIKey | XCZDEJJJBPJVNT-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|