C17H28F10O3Si — CID 156901116
1,1,2,2,3,3,4,4,5,5-decafluorotetradecyl(trimethoxy)silane (PubChem CID 156901116) has the molecular formula C17H28F10O3Si and a molecular weight of 498.47 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decafluorotetradecyl(trimethoxy)silane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decafluorotetradecyl(trimethoxy)silane |
|---|---|
| PubChem CID | 156901116 |
| Molecular Formula | C17H28F10O3Si |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decafluorotetradecyl(trimethoxy)silane |
| SMILES | CCCCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[Si](OC)(OC)OC |
| InChI | InChI=1S/C17H28F10O3Si/c1-5-6-7-8-9-10-11-12-13(18,19)14(20,21)15(22,23)16(24,25)17(26,27)31(28-2,29-3)30-4/h5-12H2,1-4H3 |
| InChIKey | ZNVYVNQIMYAEFK-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|