C11H17F9OSi — CID 3014011
ethoxy-tris(3,3,3-trifluoropropyl)silane (PubChem CID 3014011) has the molecular formula C11H17F9OSi and a molecular weight of 364.32 g/mol. Its IUPAC name is ethoxy-tris(3,3,3-trifluoropropyl)silane.
| Compound Name | ethoxy-tris(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 3014011 |
| Molecular Formula | C11H17F9OSi |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | ethoxy-tris(3,3,3-trifluoropropyl)silane |
| SMILES | CCO[Si](CCC(F)(F)F)(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C11H17F9OSi/c1-2-21-22(6-3-9(12,13)14,7-4-10(15,16)17)8-5-11(18,19)20/h2-8H2,1H3 |
| InChIKey | LTVRWXSBJFCVOP-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|