C8H14F6Si — CID 139788750
dimethyl-bis(3,3,3-trifluoropropyl)silane (PubChem CID 139788750) has the molecular formula C8H14F6Si and a molecular weight of 252.27 g/mol. Its IUPAC name is dimethyl-bis(3,3,3-trifluoropropyl)silane.
| Compound Name | dimethyl-bis(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 139788750 |
| Molecular Formula | C8H14F6Si |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | dimethyl-bis(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](C)(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C8H14F6Si/c1-15(2,5-3-7(9,10)11)6-4-8(12,13)14/h3-6H2,1-2H3 |
| InChIKey | OAJAOTKROOGBGA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|