C22H41F15O4Si5 — CID 141318833
bis[[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 141318833) has the molecular formula C22H41F15O4Si5 and a molecular weight of 794.97 g/mol. Its IUPAC name is bis[[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | bis[[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 141318833 |
| Molecular Formula | C22H41F15O4Si5 |
| Molecular Weight | 794.97 g/mol |
| Exact Mass | 794.16 |
| IUPAC Name | bis[[[dimethyl(3,3,3-trifluoropropyl)silyl]oxy-methyl-(3,3,3-trifluoropropyl)silyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(C)CCC(F)(F)F |
| InChI | InChI=1S/C22H41F15O4Si5/c1-42(2,13-8-18(23,24)25)38-44(5,15-10-20(29,30)31)40-46(7,17-12-22(35,36)37)41-45(6,16-11-21(32,33)34)39-43(3,4)14-9-19(26,27)28/h8-17H2,1-7H3 |
| InChIKey | PEDHOYJYUZLYHS-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.97 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|