C18H30F8O3Si4 — CID 165015237
trimethyl-[methyl-[methyl-[(2,3,4,5,6-pentafluorophenyl)methyl]-trimethylsilyloxysilyl]oxy-(3,3,3-trifluoropropyl)silyl]oxysilane (PubChem CID 165015237) has the molecular formula C18H30F8O3Si4 and a molecular weight of 558.76 g/mol. Its IUPAC name is trimethyl-[methyl-[methyl-[(2,3,4,5,6-pentafluorophenyl)methyl]-trimethylsilyloxysilyl]oxy-(3,3,3-trifluoropropyl)silyl]oxysilane.
| Compound Name | trimethyl-[methyl-[methyl-[(2,3,4,5,6-pentafluorophenyl)methyl]-trimethylsilyloxysilyl]oxy-(3,3,3-trifluoropropyl)silyl]oxysilane |
|---|---|
| PubChem CID | 165015237 |
| Molecular Formula | C18H30F8O3Si4 |
| Molecular Weight | 558.76 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | trimethyl-[methyl-[methyl-[(2,3,4,5,6-pentafluorophenyl)methyl]-trimethylsilyloxysilyl]oxy-(3,3,3-trifluoropropyl)silyl]oxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(CCC(F)(F)F)O[Si](C)(Cc1c(F)c(F)c(F)c(F)c1F)O[Si](C)(C)C |
| InChI | InChI=1S/C18H30F8O3Si4/c1-30(2,3)27-32(7,10-9-18(24,25)26)29-33(8,28-31(4,5)6)11-12-13(19)15(21)17(23)16(22)14(12)20/h9-11H2,1-8H3 |
| InChIKey | KHTLPQFOIILRFL-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|