C12H33F3O2Si3 — CID 158893063
methane;trimethyl-[methyl-(3,3,3-trifluoropropyl)-trimethylsilyloxysilyl]oxysilane (PubChem CID 158893063) has the molecular formula C12H33F3O2Si3 and a molecular weight of 350.65 g/mol. Its IUPAC name is methane;trimethyl-[methyl-(3,3,3-trifluoropropyl)-trimethylsilyloxysilyl]oxysilane.
| Compound Name | methane;trimethyl-[methyl-(3,3,3-trifluoropropyl)-trimethylsilyloxysilyl]oxysilane |
|---|---|
| PubChem CID | 158893063 |
| Molecular Formula | C12H33F3O2Si3 |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | methane;trimethyl-[methyl-(3,3,3-trifluoropropyl)-trimethylsilyloxysilyl]oxysilane |
| SMILES | C.C.C[Si](C)(C)O[Si](C)(CCC(F)(F)F)O[Si](C)(C)C |
| InChI | InChI=1S/C10H25F3O2Si3.2CH4/c1-16(2,3)14-18(7,15-17(4,5)6)9-8-10(11,12)13;;/h8-9H2,1-7H3;2*1H4 |
| InChIKey | JEMCEPYNWGRNRT-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|