C9H23F3O4Si3 — CID 155603003
[dimethoxy(methyl)silyl]oxy-dimethylsilyloxy-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 155603003) has the molecular formula C9H23F3O4Si3 and a molecular weight of 336.53 g/mol. Its IUPAC name is [dimethoxy(methyl)silyl]oxy-dimethylsilyloxy-methyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | [dimethoxy(methyl)silyl]oxy-dimethylsilyloxy-methyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 155603003 |
| Molecular Formula | C9H23F3O4Si3 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [dimethoxy(methyl)silyl]oxy-dimethylsilyloxy-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | CO[Si](C)(OC)O[Si](C)(CCC(F)(F)F)O[SiH](C)C |
| InChI | InChI=1S/C9H23F3O4Si3/c1-13-19(6,14-2)16-18(5,15-17(3)4)8-7-9(10,11)12/h17H,7-8H2,1-6H3 |
| InChIKey | KYWYAJYBTIRYKM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|