C12H28F6O3Si4 — CID 140823949
dimethylsilyloxy-[dimethylsilyloxy-bis(3,3,3-trifluoropropyl)silyl]oxy-dimethylsilane (PubChem CID 140823949) has the molecular formula C12H28F6O3Si4 and a molecular weight of 446.69 g/mol. Its IUPAC name is dimethylsilyloxy-[dimethylsilyloxy-bis(3,3,3-trifluoropropyl)silyl]oxy-dimethylsilane.
| Compound Name | dimethylsilyloxy-[dimethylsilyloxy-bis(3,3,3-trifluoropropyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140823949 |
| Molecular Formula | C12H28F6O3Si4 |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | dimethylsilyloxy-[dimethylsilyloxy-bis(3,3,3-trifluoropropyl)silyl]oxy-dimethylsilane |
| SMILES | C[SiH](C)O[Si](C)(C)O[Si](CCC(F)(F)F)(CCC(F)(F)F)O[SiH](C)C |
| InChI | InChI=1S/C12H28F6O3Si4/c1-22(2)19-24(5,6)21-25(20-23(3)4,9-7-11(13,14)15)10-8-12(16,17)18/h22-23H,7-10H2,1-6H3 |
| InChIKey | XVYJNAWEAGCMQL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|