About [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol
[dimethoxy(3,3,3-trifluoropropyl)silyl]methanol (PubChem CID 89089396) has the molecular formula C6H13F3O3Si
and a molecular weight of 218.25 g/mol. Its IUPAC name is [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol.
Molecular Properties
| Compound Name | [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol |
| PubChem CID | 89089396 |
| Molecular Formula | C6H13F3O3Si |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol |
| SMILES | CO[Si](CO)(CCC(F)(F)F)OC |
| InChI | InChI=1S/C6H13F3O3Si/c1-11-13(5-10,12-2)4-3-6(7,8)9/h10H,3-5H2,1-2H3 |
| InChIKey | OUWWFUFAIBAWRG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol?
The IUPAC name of [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol (CID 89089396) is [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol.
What is the SMILES notation for [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol?
The canonical SMILES for [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol is CO[Si](CO)(CCC(F)(F)F)OC.
What is the InChIKey of [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol?
The InChIKey is OUWWFUFAIBAWRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F3O3Si/c1-11-13(5-10,12-2)4-3-6(7,8)9/h10H,3-5H2,1-2H3.
What are the key properties of [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol?
[dimethoxy(3,3,3-trifluoropropyl)silyl]methanol has a molecular weight of 218.25 g/mol, XLogP of 1.21, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethoxy(3,3,3-trifluoropropyl)silyl]methanol is sourced from PubChem (CID 89089396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).