C11H26O5Si2 — CID 58151722
[2-[ethenyl(diethoxy)silyl]ethyl-dimethoxysilyl]methanol (PubChem CID 58151722) has the molecular formula C11H26O5Si2 and a molecular weight of 294.50 g/mol. Its IUPAC name is [2-[ethenyl(diethoxy)silyl]ethyl-dimethoxysilyl]methanol.
| Compound Name | [2-[ethenyl(diethoxy)silyl]ethyl-dimethoxysilyl]methanol |
|---|---|
| PubChem CID | 58151722 |
| Molecular Formula | C11H26O5Si2 |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [2-[ethenyl(diethoxy)silyl]ethyl-dimethoxysilyl]methanol |
| SMILES | C=C[Si](CC[Si](CO)(OC)OC)(OCC)OCC |
| InChI | InChI=1S/C11H26O5Si2/c1-6-15-17(8-3,16-7-2)9-10-18(11-12,13-4)14-5/h8,12H,3,6-7,9-11H2,1-2,4-5H3 |
| InChIKey | KQTUODWTKLZFAT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|