About ethenyl-dimethoxy-methylsilane;tetraethyl silicate
ethenyl-dimethoxy-methylsilane;tetraethyl silicate (PubChem CID 161359960) has the molecular formula C13H32O6Si2
and a molecular weight of 340.57 g/mol. Its IUPAC name is ethenyl-dimethoxy-methylsilane;tetraethyl silicate.
Molecular Properties
| Compound Name | ethenyl-dimethoxy-methylsilane;tetraethyl silicate |
| PubChem CID | 161359960 |
| Molecular Formula | C13H32O6Si2 |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | ethenyl-dimethoxy-methylsilane;tetraethyl silicate |
| SMILES | C=C[Si](C)(OC)OC.CCO[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C8H20O4Si.C5H12O2Si/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-5-8(4,6-2)7-3/h5-8H2,1-4H3;5H,1H2,2-4H3 |
| InChIKey | VPAUVHVKGLAXCZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-dimethoxy-methylsilane;tetraethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-dimethoxy-methylsilane;tetraethyl silicate?
The IUPAC name of ethenyl-dimethoxy-methylsilane;tetraethyl silicate (CID 161359960) is ethenyl-dimethoxy-methylsilane;tetraethyl silicate.
What is the SMILES notation for ethenyl-dimethoxy-methylsilane;tetraethyl silicate?
The canonical SMILES for ethenyl-dimethoxy-methylsilane;tetraethyl silicate is C=C[Si](C)(OC)OC.CCO[Si](OCC)(OCC)OCC.
What is the InChIKey of ethenyl-dimethoxy-methylsilane;tetraethyl silicate?
The InChIKey is VPAUVHVKGLAXCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O4Si.C5H12O2Si/c1-5-9-13(10-6-2,11-7-3)12-8-4;1-5-8(4,6-2)7-3/h5-8H2,1-4H3;5H,1H2,2-4H3.
What are the key properties of ethenyl-dimethoxy-methylsilane;tetraethyl silicate?
ethenyl-dimethoxy-methylsilane;tetraethyl silicate has a molecular weight of 340.57 g/mol, XLogP of 2.64, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-dimethoxy-methylsilane;tetraethyl silicate is sourced from PubChem (CID 161359960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).