About ethyl tris(trimethylsilyl) silicate
ethyl tris(trimethylsilyl) silicate (PubChem CID 624542) has the molecular formula C11H32O4Si4
and a molecular weight of 340.72 g/mol. Its IUPAC name is ethyl tris(trimethylsilyl) silicate.
Molecular Properties
| Compound Name | ethyl tris(trimethylsilyl) silicate |
| PubChem CID | 624542 |
| Molecular Formula | C11H32O4Si4 |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl tris(trimethylsilyl) silicate |
| SMILES | CCO[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H32O4Si4/c1-11-12-19(13-16(2,3)4,14-17(5,6)7)15-18(8,9)10/h11H2,1-10H3 |
| InChIKey | RXDPPOMCFULIIG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl tris(trimethylsilyl) silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl tris(trimethylsilyl) silicate?
The IUPAC name of ethyl tris(trimethylsilyl) silicate (CID 624542) is ethyl tris(trimethylsilyl) silicate.
What is the SMILES notation for ethyl tris(trimethylsilyl) silicate?
The canonical SMILES for ethyl tris(trimethylsilyl) silicate is CCO[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of ethyl tris(trimethylsilyl) silicate?
The InChIKey is RXDPPOMCFULIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H32O4Si4/c1-11-12-19(13-16(2,3)4,14-17(5,6)7)15-18(8,9)10/h11H2,1-10H3.
What are the key properties of ethyl tris(trimethylsilyl) silicate?
ethyl tris(trimethylsilyl) silicate has a molecular weight of 340.72 g/mol, XLogP of 4.01, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl tris(trimethylsilyl) silicate is sourced from PubChem (CID 624542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).