C23H68O10Si10 — CID 24766878
ethyl tris[methyl-bis(trimethylsilyloxy)silyl] silicate (PubChem CID 24766878) has the molecular formula C23H68O10Si10 and a molecular weight of 785.65 g/mol. Its IUPAC name is ethyl tris[methyl-bis(trimethylsilyloxy)silyl] silicate.
| Compound Name | ethyl tris[methyl-bis(trimethylsilyloxy)silyl] silicate |
|---|---|
| PubChem CID | 24766878 |
| Molecular Formula | C23H68O10Si10 |
| Molecular Weight | 785.65 g/mol |
| Exact Mass | 784.25 |
| IUPAC Name | ethyl tris[methyl-bis(trimethylsilyloxy)silyl] silicate |
| SMILES | CCO[Si](O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)(O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H68O10Si10/c1-23-24-43(31-40(20,25-34(2,3)4)26-35(5,6)7,32-41(21,27-36(8,9)10)28-37(11,12)13)33-42(22,29-38(14,15)16)30-39(17,18)19/h23H2,1-22H3 |
| InChIKey | LVAKVXLLYYEAOY-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.65 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|