C13H40O6Si6 — CID 87102774
hydroxy-[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silane (PubChem CID 87102774) has the molecular formula C13H40O6Si6 and a molecular weight of 460.97 g/mol. Its IUPAC name is hydroxy-[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silane.
| Compound Name | hydroxy-[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 87102774 |
| Molecular Formula | C13H40O6Si6 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | hydroxy-[methyl-bis(trimethylsilyloxy)silyl]oxy-bis(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](O)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H40O6Si6/c1-20(2,3)15-24(13,16-21(4,5)6)19-25(14,17-22(7,8)9)18-23(10,11)12/h14H,1-13H3 |
| InChIKey | LAQJLYFOPZXWDT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|