C15H46O7Si7 — CID 140863121
hydroxy-methyl-bis[[methyl-bis(trimethylsilyloxy)silyl]oxy]silane (PubChem CID 140863121) has the molecular formula C15H46O7Si7 and a molecular weight of 535.13 g/mol. Its IUPAC name is hydroxy-methyl-bis[[methyl-bis(trimethylsilyloxy)silyl]oxy]silane.
| Compound Name | hydroxy-methyl-bis[[methyl-bis(trimethylsilyloxy)silyl]oxy]silane |
|---|---|
| PubChem CID | 140863121 |
| Molecular Formula | C15H46O7Si7 |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | hydroxy-methyl-bis[[methyl-bis(trimethylsilyloxy)silyl]oxy]silane |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(O)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H46O7Si7/c1-23(2,3)17-28(14,18-24(4,5)6)21-27(13,16)22-29(15,19-25(7,8)9)20-26(10,11)12/h16H,1-15H3 |
| InChIKey | PAXIVSSPGAXRMM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|