About stannane;trimethyl(trimethylsilyloxy)silane
stannane;trimethyl(trimethylsilyloxy)silane (PubChem CID 174893818) has the molecular formula C6H22OSi2Sn
and a molecular weight of 285.12 g/mol. Its IUPAC name is stannane;trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | stannane;trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 174893818 |
| Molecular Formula | C6H22OSi2Sn |
| Molecular Weight | 285.12 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | stannane;trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.[SnH4] |
| InChI | InChI=1S/C6H18OSi2.Sn.4H/c1-8(2,3)7-9(4,5)6;;;;;/h1-6H3;;;;; |
| InChIKey | ODCPUNUFGKSSRR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.12 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze stannane;trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of stannane;trimethyl(trimethylsilyloxy)silane?
The IUPAC name of stannane;trimethyl(trimethylsilyloxy)silane (CID 174893818) is stannane;trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for stannane;trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for stannane;trimethyl(trimethylsilyloxy)silane is C[Si](C)(C)O[Si](C)(C)C.[SnH4].
What is the InChIKey of stannane;trimethyl(trimethylsilyloxy)silane?
The InChIKey is ODCPUNUFGKSSRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18OSi2.Sn.4H/c1-8(2,3)7-9(4,5)6;;;;;/h1-6H3;;;;;.
What are the key properties of stannane;trimethyl(trimethylsilyloxy)silane?
stannane;trimethyl(trimethylsilyloxy)silane has a molecular weight of 285.12 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for stannane;trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 174893818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).