About bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane
bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane (PubChem CID 159429398) has the molecular formula C14H38OSi2
and a molecular weight of 278.63 g/mol. Its IUPAC name is bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 159429398 |
| Molecular Formula | C14H38OSi2 |
| Molecular Weight | 278.63 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane |
| SMILES | CC(C)C.CC(C)C.C[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C6H18OSi2.2C4H10/c1-8(2,3)7-9(4,5)6;2*1-4(2)3/h1-6H3;2*4H,1-3H3 |
| InChIKey | LQUGBKPWJZLIMG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane?
The IUPAC name of bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane (CID 159429398) is bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane is CC(C)C.CC(C)C.C[Si](C)(C)O[Si](C)(C)C.
What is the InChIKey of bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane?
The InChIKey is LQUGBKPWJZLIMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18OSi2.2C4H10/c1-8(2,3)7-9(4,5)6;2*1-4(2)3/h1-6H3;2*4H,1-3H3.
What are the key properties of bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane?
bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane has a molecular weight of 278.63 g/mol, XLogP of 6.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropane);trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 159429398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).