C14H40O4Si5 — CID 20593735
bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methyl-propan-2-ylsilane (PubChem CID 20593735) has the molecular formula C14H40O4Si5 and a molecular weight of 412.90 g/mol. Its IUPAC name is bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methyl-propan-2-ylsilane.
| Compound Name | bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methyl-propan-2-ylsilane |
|---|---|
| PubChem CID | 20593735 |
| Molecular Formula | C14H40O4Si5 |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methyl-propan-2-ylsilane |
| SMILES | CC(C)[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H40O4Si5/c1-14(2)23(13,17-21(9,10)15-19(3,4)5)18-22(11,12)16-20(6,7)8/h14H,1-13H3 |
| InChIKey | RRMQDRLZNSTFPU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|